ChemNet > CAS > 423768-38-1 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride
423768-38-1 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride
produktnavn |
1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride |
Synonymer |
1-methyl-1H-benzotriazole-5-carbonyl chloride |
Molekylær Formel |
C8H6ClN3O |
Molekylvekt |
195.6057 |
InChI |
InChI=1/C8H6ClN3O/c1-12-7-3-2-5(8(9)13)4-6(7)10-11-12/h2-4H,1H3 |
CAS-nummer |
423768-38-1 |
Molecular Structure |
|
Tetthet |
1.5g/cm3 |
Smeltepunkt |
123℃ |
Kokepunkt |
355.3°C at 760 mmHg |
Brytningsindeks |
1.687 |
Flammepunktet |
168.7°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|